C21H28F3N5O4 — CID 118744669
8-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 118744669) has the molecular formula C21H28F3N5O4 and a molecular weight of 471.48 g/mol. Its IUPAC name is 8-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 8-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744669 |
| Molecular Formula | C21H28F3N5O4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 8-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methyl-4-(1-methylpyrazol-4-yl)-1,8-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1CCC2(CC1)C(c1cnn(C)c1)CC(=O)N2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N5O2.C2HF3O2/c1-13-16(14(2)26-21-13)12-24-7-5-19(6-8-24)17(9-18(25)23(19)4)15-10-20-22(3)11-15;3-2(4,5)1(6)7/h10-11,17H,5-9,12H2,1-4H3;(H,6,7) |
| InChIKey | IRRGWNAMMLUWIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |