C20H26F3N5O5 — CID 118745020
N-(3-methoxypropyl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118745020) has the molecular formula C20H26F3N5O5 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-methoxypropyl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745020 |
| Molecular Formula | C20H26F3N5O5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-(3-methoxypropyl)-1-methyl-4-(2-morpholin-4-ylpyrimidin-5-yl)pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNC(=O)c1cc(-c2cnc(N3CCOCC3)nc2)cn1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N5O3.C2HF3O2/c1-22-13-14(10-16(22)17(24)19-4-3-7-25-2)15-11-20-18(21-12-15)23-5-8-26-9-6-23;3-2(4,5)1(6)7/h10-13H,3-9H2,1-2H3,(H,19,24);(H,6,7) |
| InChIKey | XQFVLARMRJJXHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|