C19H23F3N4O3S2 — CID 118745113
[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,8-diazaspiro[4.5]decan-2-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 118745113) has the molecular formula C19H23F3N4O3S2 and a molecular weight of 476.55 g/mol. Its IUPAC name is [8-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,8-diazaspiro[4.5]decan-2-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [8-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,8-diazaspiro[4.5]decan-2-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745113 |
| Molecular Formula | C19H23F3N4O3S2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [8-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,8-diazaspiro[4.5]decan-2-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCC3(CC2)CCN(C(=O)c2cscn2)C3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4OS2.C2HF3O2/c1-13-19-14(9-24-13)8-20-5-2-17(3-6-20)4-7-21(11-17)16(22)15-10-23-12-18-15;3-2(4,5)1(6)7/h9-10,12H,2-8,11H2,1H3;(H,6,7) |
| InChIKey | JBFNPJQICQHJHZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |