C15H22F3N3O3 — CID 118745156
8-(cyclopropylmethyl)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 118745156) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(cyclopropylmethyl)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745156 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 8-(cyclopropylmethyl)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | COCC1CN(CC2CC2)Cc2nccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3O.C2HF3O2/c1-17-10-12-7-15(6-11-2-3-11)9-13-14-4-5-16(13)8-12;3-2(4,5)1(6)7/h4-5,11-12H,2-3,6-10H2,1H3;(H,6,7) |
| InChIKey | YQLKBNCFHATYGO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |