C17H20F3N5O5S — CID 118745166
N-[(3-pyridin-4-yl-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl)methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 118745166) has the molecular formula C17H20F3N5O5S and a molecular weight of 463.44 g/mol. Its IUPAC name is N-[(3-pyridin-4-yl-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl)methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3-pyridin-4-yl-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl)methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745166 |
| Molecular Formula | C17H20F3N5O5S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-[(3-pyridin-4-yl-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl)methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(NCC1COCc2c(-c3ccncc3)nnn2C1)C1CC1 |
| InChI | InChI=1S/C15H19N5O3S.C2HF3O2/c21-24(22,13-1-2-13)17-7-11-8-20-14(10-23-9-11)15(18-19-20)12-3-5-16-6-4-12;3-2(4,5)1(6)7/h3-6,11,13,17H,1-2,7-10H2;(H,6,7) |
| InChIKey | CNTFCWQAEZRRJA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |