About (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone
(11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone (PubChem CID 118745351) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone.
Molecular Properties
| Compound Name | (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone |
| PubChem CID | 118745351 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone |
| SMILES | CN1CCOCC2(CCCN(C(=O)c3cnccn3)C2)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-18-7-8-21-12-15(10-18)3-2-6-19(11-15)14(20)13-9-16-4-5-17-13/h4-5,9H,2-3,6-8,10-12H2,1H3 |
| InChIKey | PYDTZPVNIGJIFT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone?
The IUPAC name of (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone (CID 118745351) is (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone.
What is the SMILES notation for (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone?
The canonical SMILES for (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone is CN1CCOCC2(CCCN(C(=O)c3cnccn3)C2)C1.
What is the InChIKey of (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone?
The InChIKey is PYDTZPVNIGJIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-18-7-8-21-12-15(10-18)3-2-6-19(11-15)14(20)13-9-16-4-5-17-13/h4-5,9H,2-3,6-8,10-12H2,1H3.
What are the key properties of (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone?
(11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone has a molecular weight of 290.37 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecan-2-yl)-pyrazin-2-ylmethanone is sourced from PubChem (CID 118745351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).