C18H21F3N6O2S — CID 118745371
1-[(5-methyltriazol-1-yl)methyl]-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 118745371) has the molecular formula C18H21F3N6O2S and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[(5-methyltriazol-1-yl)methyl]-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(5-methyltriazol-1-yl)methyl]-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745371 |
| Molecular Formula | C18H21F3N6O2S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[(5-methyltriazol-1-yl)methyl]-8-(thiophen-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cnnn1Cc1ncn2c1CN(Cc1cccs1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N6S.C2HF3O2/c1-13-8-18-19-22(13)10-15-16-11-20(9-14-4-2-7-23-14)5-3-6-21(16)12-17-15;3-2(4,5)1(6)7/h2,4,7-8,12H,3,5-6,9-11H2,1H3;(H,6,7) |
| InChIKey | MBPXINVBRCDIAE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |