C20H19F3N4O2S — CID 118745382
7-(pyridin-2-ylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid (PubChem CID 118745382) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is 7-(pyridin-2-ylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(pyridin-2-ylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745382 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 7-(pyridin-2-ylmethyl)-4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(CN2CCc3ncnc(-c4ccsc4)c3CC2)nc1 |
| InChI | InChI=1S/C18H18N4S.C2HF3O2/c1-2-7-19-15(3-1)11-22-8-4-16-17(5-9-22)20-13-21-18(16)14-6-10-23-12-14;3-2(4,5)1(6)7/h1-3,6-7,10,12-13H,4-5,8-9,11H2;(H,6,7) |
| InChIKey | BESFHVOHHGALSZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |