About 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea
3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea (PubChem CID 118745398) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea |
| PubChem CID | 118745398 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1COC2(CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-20(2)17(22)19-16-12-18(23-14-16)8-10-21(11-9-18)13-15-6-4-3-5-7-15/h3-7,16H,8-14H2,1-2H3,(H,19,22) |
| InChIKey | XFGYJVQBSHKLKL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea?
The IUPAC name of 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea (CID 118745398) is 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea.
What is the SMILES notation for 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea?
The canonical SMILES for 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea is CN(C)C(=O)NC1COC2(CCN(Cc3ccccc3)CC2)C1.
What is the InChIKey of 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea?
The InChIKey is XFGYJVQBSHKLKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-20(2)17(22)19-16-12-18(23-14-16)8-10-21(11-9-18)13-15-6-4-3-5-7-15/h3-7,16H,8-14H2,1-2H3,(H,19,22).
What are the key properties of 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea?
3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea has a molecular weight of 317.43 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-benzyl-1-oxa-8-azaspiro[4.5]decan-3-yl)-1,1-dimethylurea is sourced from PubChem (CID 118745398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).