C17H21F3N4O3S — CID 118745402
N,N-dimethyl-7-[(5-methylthiophen-2-yl)methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118745402) has the molecular formula C17H21F3N4O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is N,N-dimethyl-7-[(5-methylthiophen-2-yl)methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-7-[(5-methylthiophen-2-yl)methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745402 |
| Molecular Formula | C17H21F3N4O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N,N-dimethyl-7-[(5-methylthiophen-2-yl)methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCn3c(C(=O)N(C)C)cnc3C2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H20N4OS.C2HF3O2/c1-11-4-5-12(21-11)9-18-6-7-19-13(15(20)17(2)3)8-16-14(19)10-18;3-2(4,5)1(6)7/h4-5,8H,6-7,9-10H2,1-3H3;(H,6,7) |
| InChIKey | IXHQDSXOFGREPC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |