About 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one
1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one (PubChem CID 118745442) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one.
Molecular Properties
| Compound Name | 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one |
| PubChem CID | 118745442 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one |
| SMILES | CCN1C(=O)CCC12CCCN(Cc1nccs1)CC2 |
| InChI | InChI=1S/C15H23N3OS/c1-2-18-14(19)4-6-15(18)5-3-9-17(10-7-15)12-13-16-8-11-20-13/h8,11H,2-7,9-10,12H2,1H3 |
| InChIKey | OBNPDFDEQIXXSX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one?
The IUPAC name of 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one (CID 118745442) is 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one.
What is the SMILES notation for 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one?
The canonical SMILES for 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one is CCN1C(=O)CCC12CCCN(Cc1nccs1)CC2.
What is the InChIKey of 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one?
The InChIKey is OBNPDFDEQIXXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-2-18-14(19)4-6-15(18)5-3-9-17(10-7-15)12-13-16-8-11-20-13/h8,11H,2-7,9-10,12H2,1H3.
What are the key properties of 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one?
1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one has a molecular weight of 293.44 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-9-(1,3-thiazol-2-ylmethyl)-1,9-diazaspiro[4.6]undecan-2-one is sourced from PubChem (CID 118745442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).