C19H28F6N4O4 — CID 118745835
1-[7-(cyclopentylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745835) has the molecular formula C19H28F6N4O4 and a molecular weight of 490.45 g/mol. Its IUPAC name is 1-[7-(cyclopentylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[7-(cyclopentylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745835 |
| Molecular Formula | C19H28F6N4O4 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 1-[7-(cyclopentylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)Cc1cn2c(n1)CN(CC1CCCC1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N4.2C2HF3O2/c1-17(2)10-14-11-19-8-7-18(12-15(19)16-14)9-13-5-3-4-6-13;2*3-2(4,5)1(6)7/h11,13H,3-10,12H2,1-2H3;2*(H,6,7) |
| InChIKey | LGPMCMHPYPCJNN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |