C21H29F6N5O6 — CID 118746010
N,N-dimethyl-2-[[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746010) has the molecular formula C21H29F6N5O6 and a molecular weight of 561.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746010 |
| Molecular Formula | C21H29F6N5O6 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | N,N-dimethyl-2-[[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CCc3nnc(COCCN(C)C)n3CC2)o1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5O2.2C2HF3O2/c1-14-4-5-15(24-14)12-21-7-6-16-18-19-17(22(16)9-8-21)13-23-11-10-20(2)3;2*3-2(4,5)1(6)7/h4-5H,6-13H2,1-3H3;2*(H,6,7) |
| InChIKey | PCCGWKFCMHHWCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|