C21H26F6N4O6S — CID 118746016
N,N-dimethyl-2-[[1-methyl-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-7-yl]methoxy]acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746016) has the molecular formula C21H26F6N4O6S and a molecular weight of 576.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[1-methyl-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-7-yl]methoxy]acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[[1-methyl-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-7-yl]methoxy]acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746016 |
| Molecular Formula | C21H26F6N4O6S |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | N,N-dimethyl-2-[[1-methyl-5-(thiophen-2-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridin-7-yl]methoxy]acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)COCC1CN(Cc2cccs2)Cc2ncn(C)c21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O2S.2C2HF3O2/c1-19(2)16(22)11-23-10-13-7-21(8-14-5-4-6-24-14)9-15-17(13)20(3)12-18-15;2*3-2(4,5)1(6)7/h4-6,12-13H,7-11H2,1-3H3;2*(H,6,7) |
| InChIKey | MZZAUASBHKAUKK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |