C22H24F6N4O5 — CID 118746039
4-(oxolan-3-yl)-7-(pyridin-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746039) has the molecular formula C22H24F6N4O5 and a molecular weight of 538.45 g/mol. Its IUPAC name is 4-(oxolan-3-yl)-7-(pyridin-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(oxolan-3-yl)-7-(pyridin-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746039 |
| Molecular Formula | C22H24F6N4O5 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 4-(oxolan-3-yl)-7-(pyridin-2-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CN2CCc3ncnc(C4CCOC4)c3CC2)nc1 |
| InChI | InChI=1S/C18H22N4O.2C2HF3O2/c1-2-7-19-15(3-1)11-22-8-4-16-17(5-9-22)20-13-21-18(16)14-6-10-23-12-14;2*3-2(4,5)1(6)7/h1-3,7,13-14H,4-6,8-12H2;2*(H,6,7) |
| InChIKey | PSGZSMHWYLUUMA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |