C21H21F6N5O5S — CID 118746116
3-(pyridin-3-ylmethoxymethyl)-7-(thiophen-2-ylmethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746116) has the molecular formula C21H21F6N5O5S and a molecular weight of 569.48 g/mol. Its IUPAC name is 3-(pyridin-3-ylmethoxymethyl)-7-(thiophen-2-ylmethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-(pyridin-3-ylmethoxymethyl)-7-(thiophen-2-ylmethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746116 |
| Molecular Formula | C21H21F6N5O5S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 3-(pyridin-3-ylmethoxymethyl)-7-(thiophen-2-ylmethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(COCc2nnc3n2CCN(Cc2cccs2)C3)c1 |
| InChI | InChI=1S/C17H19N5OS.2C2HF3O2/c1-3-14(9-18-5-1)12-23-13-17-20-19-16-11-21(6-7-22(16)17)10-15-4-2-8-24-15;2*3-2(4,5)1(6)7/h1-5,8-9H,6-7,10-13H2;2*(H,6,7) |
| InChIKey | CRRZHSZFUHGCBF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |