C17H25N5S — CID 118746156
2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole (PubChem CID 118746156) has the molecular formula C17H25N5S and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 118746156 |
| Molecular Formula | C17H25N5S |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-methyl-4-[[6-(pyrrolidin-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nc(CN2Cc3nccn3CC(CN3CCCC3)C2)cs1 |
| InChI | InChI=1S/C17H25N5S/c1-14-19-16(13-23-14)11-21-9-15(8-20-5-2-3-6-20)10-22-7-4-18-17(22)12-21/h4,7,13,15H,2-3,5-6,8-12H2,1H3 |
| InChIKey | FELHWEPLTOEDHP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |