C21H27F6N5O5S — CID 118746157
4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746157) has the molecular formula C21H27F6N5O5S and a molecular weight of 575.53 g/mol. Its IUPAC name is 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746157 |
| Molecular Formula | C21H27F6N5O5S |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2Cc3nccn3CC(CN3CCOCC3)C2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5OS.2C2HF3O2/c1-14-19-16(13-24-14)11-21-9-15(8-20-4-6-23-7-5-20)10-22-3-2-18-17(22)12-21;2*3-2(4,5)1(6)7/h2-3,13,15H,4-12H2,1H3;2*(H,6,7) |
| InChIKey | NIDPEMFSEFJSEP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |