C17H25N5OS — CID 118746158
4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine (PubChem CID 118746158) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine.
| Compound Name | 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine |
|---|---|
| PubChem CID | 118746158 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-[[8-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]morpholine |
| SMILES | Cc1nc(CN2Cc3nccn3CC(CN3CCOCC3)C2)cs1 |
| InChI | InChI=1S/C17H25N5OS/c1-14-19-16(13-24-14)11-21-9-15(8-20-4-6-23-7-5-20)10-22-3-2-18-17(22)12-21/h2-3,13,15H,4-12H2,1H3 |
| InChIKey | MNRKANROLNXJBA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |