About 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane
2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane (PubChem CID 118746160) has the molecular formula C16H20N6
and a molecular weight of 296.38 g/mol. Its IUPAC name is 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane |
| PubChem CID | 118746160 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane |
| SMILES | c1cnc(N2CCCC3(CCN(c4ncccn4)C3)C2)nc1 |
| InChI | InChI=1S/C16H20N6/c1-4-16(12-21(10-1)14-17-6-2-7-18-14)5-11-22(13-16)15-19-8-3-9-20-15/h2-3,6-9H,1,4-5,10-13H2 |
| InChIKey | QNNTVDUAIZOLLY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane?
The IUPAC name of 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane (CID 118746160) is 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane?
The canonical SMILES for 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane is c1cnc(N2CCCC3(CCN(c4ncccn4)C3)C2)nc1.
What is the InChIKey of 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane?
The InChIKey is QNNTVDUAIZOLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6/c1-4-16(12-21(10-1)14-17-6-2-7-18-14)5-11-22(13-16)15-19-8-3-9-20-15/h2-3,6-9H,1,4-5,10-13H2.
What are the key properties of 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane?
2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane has a molecular weight of 296.38 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-di(pyrimidin-2-yl)-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 118746160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).