C22H28F6N4O4S — CID 118746178
3-(piperidin-1-ylmethyl)-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746178) has the molecular formula C22H28F6N4O4S and a molecular weight of 558.55 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-(piperidin-1-ylmethyl)-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746178 |
| Molecular Formula | C22H28F6N4O4S |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)-7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc(CN2CCc3ncc(CN4CCCCC4)n3CC2)cs1 |
| InChI | InChI=1S/C18H26N4S.2C2HF3O2/c1-2-6-20(7-3-1)14-17-12-19-18-4-8-21(9-10-22(17)18)13-16-5-11-23-15-16;2*3-2(4,5)1(6)7/h5,11-12,15H,1-4,6-10,13-14H2;2*(H,6,7) |
| InChIKey | KWCUSBKZRCAFCA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |