C21H26F6N4O5S — CID 118746179
4-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746179) has the molecular formula C21H26F6N4O5S and a molecular weight of 560.52 g/mol. Its IUPAC name is 4-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746179 |
| Molecular Formula | C21H26F6N4O5S |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 4-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc(CN2CCc3ncc(CN4CCOCC4)n3CC2)cs1 |
| InChI | InChI=1S/C17H24N4OS.2C2HF3O2/c1-3-19(12-15-2-10-23-14-15)4-5-21-16(11-18-17(1)21)13-20-6-8-22-9-7-20;2*3-2(4,5)1(6)7/h2,10-11,14H,1,3-9,12-13H2;2*(H,6,7) |
| InChIKey | FPEQEHRMZHMVBO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |