C19H27F6N3O6S — CID 118746449
8-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746449) has the molecular formula C19H27F6N3O6S and a molecular weight of 539.50 g/mol. Its IUPAC name is 8-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746449 |
| Molecular Formula | C19H27F6N3O6S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 8-propan-2-yl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)N1CCOCC2(CN(Cc3nccs3)CCO2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O2S.2C2HF3O2/c1-13(2)18-5-6-19-12-15(11-18)10-17(4-7-20-15)9-14-16-3-8-21-14;2*3-2(4,5)1(6)7/h3,8,13H,4-7,9-12H2,1-2H3;2*(H,6,7) |
| InChIKey | NXKFAJJSTKCPLJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |