C20H26F6N4O6S — CID 118746534
4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746534) has the molecular formula C20H26F6N4O6S and a molecular weight of 564.51 g/mol. Its IUPAC name is 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746534 |
| Molecular Formula | C20H26F6N4O6S |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1Cc2nccn2CC(COCc2csc(C)n2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2S.2C2HF3O2/c1-13-18-15(12-23-13)11-22-10-14-7-19(5-6-21-2)9-16-17-3-4-20(16)8-14;2*3-2(4,5)1(6)7/h3-4,12,14H,5-11H2,1-2H3;2*(H,6,7) |
| InChIKey | LAAAKMTVJLEPMW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |