C16H24N4O2S — CID 118746535
4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole (PubChem CID 118746535) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 118746535 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[[8-(2-methoxyethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methoxymethyl]-2-methyl-1,3-thiazole |
| SMILES | COCCN1Cc2nccn2CC(COCc2csc(C)n2)C1 |
| InChI | InChI=1S/C16H24N4O2S/c1-13-18-15(12-23-13)11-22-10-14-7-19(5-6-21-2)9-16-17-3-4-20(16)8-14/h3-4,12,14H,5-11H2,1-2H3 |
| InChIKey | QLLDBVNBYCWMAO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |