C19H24F6N4O5S — CID 118746541
4-[(8-ethyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746541) has the molecular formula C19H24F6N4O5S and a molecular weight of 534.48 g/mol. Its IUPAC name is 4-[(8-ethyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[(8-ethyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746541 |
| Molecular Formula | C19H24F6N4O5S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 4-[(8-ethyl-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl)methoxymethyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1Cc2nccn2CC(COCc2csc(C)n2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4OS.2C2HF3O2/c1-3-18-6-13(7-19-5-4-16-15(19)8-18)9-20-10-14-11-21-12(2)17-14;2*3-2(4,5)1(6)7/h4-5,11,13H,3,6-10H2,1-2H3;2*(H,6,7) |
| InChIKey | VCRQWNQVAUKUPY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |