C22H21F6N5O4S — CID 118746671
2-methyl-4-[(4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746671) has the molecular formula C22H21F6N5O4S and a molecular weight of 565.50 g/mol. Its IUPAC name is 2-methyl-4-[(4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methyl-4-[(4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746671 |
| Molecular Formula | C22H21F6N5O4S |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2-methyl-4-[(4-pyridin-4-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCc3ncnc(-c4ccncc4)c3CC2)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N5S.2C2HF3O2/c1-13-22-15(11-24-13)10-23-8-4-16-17(5-9-23)20-12-21-18(16)14-2-6-19-7-3-14;2*3-2(4,5)1(6)7/h2-3,6-7,11-12H,4-5,8-10H2,1H3;2*(H,6,7) |
| InChIKey | ALXMVBPZITXZHW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |