About 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine
5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine (PubChem CID 118746678) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine |
| PubChem CID | 118746678 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine |
| SMILES | CCOCCN1Cc2cnn(C)c2C(COCC)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-4-18-7-6-17-9-12-8-15-16(3)14(12)13(10-17)11-19-5-2/h8,13H,4-7,9-11H2,1-3H3 |
| InChIKey | MIFQPXANJURWOB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine?
The IUPAC name of 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine (CID 118746678) is 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine.
What is the SMILES notation for 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine?
The canonical SMILES for 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine is CCOCCN1Cc2cnn(C)c2C(COCC)C1.
What is the InChIKey of 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine?
The InChIKey is MIFQPXANJURWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2/c1-4-18-7-6-17-9-12-8-15-16(3)14(12)13(10-17)11-19-5-2/h8,13H,4-7,9-11H2,1-3H3.
What are the key properties of 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine?
5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine has a molecular weight of 267.37 g/mol, XLogP of 1.39, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethoxyethyl)-7-(ethoxymethyl)-1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine is sourced from PubChem (CID 118746678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).