C19H19F6N7O4 — CID 118746707
7-(pyridin-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746707) has the molecular formula C19H19F6N7O4 and a molecular weight of 523.39 g/mol. Its IUPAC name is 7-(pyridin-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(pyridin-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746707 |
| Molecular Formula | C19H19F6N7O4 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 7-(pyridin-3-ylmethyl)-3-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(CN2CCn3c(Cn4cncn4)cnc3C2)c1 |
| InChI | InChI=1S/C15H17N7.2C2HF3O2/c1-2-13(6-16-3-1)8-20-4-5-22-14(7-18-15(22)10-20)9-21-12-17-11-19-21;2*3-2(4,5)1(6)7/h1-3,6-7,11-12H,4-5,8-10H2;2*(H,6,7) |
| InChIKey | CDRMIKJJITYRDM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |