About 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane
10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane (PubChem CID 118747244) has the molecular formula C20H24F2N4
and a molecular weight of 358.44 g/mol. Its IUPAC name is 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane |
| PubChem CID | 118747244 |
| Molecular Formula | C20H24F2N4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane |
| SMILES | FC1(F)CCN(Cc2ccncc2)CC12CCN(Cc1ccccn1)C2 |
| InChI | InChI=1S/C20H24F2N4/c21-20(22)7-12-25(13-17-4-9-23-10-5-17)15-19(20)6-11-26(16-19)14-18-3-1-2-8-24-18/h1-5,8-10H,6-7,11-16H2 |
| InChIKey | UIVNGWMALJSRNJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane?
The IUPAC name of 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane (CID 118747244) is 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane?
The canonical SMILES for 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane is FC1(F)CCN(Cc2ccncc2)CC12CCN(Cc1ccccn1)C2.
What is the InChIKey of 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane?
The InChIKey is UIVNGWMALJSRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24F2N4/c21-20(22)7-12-25(13-17-4-9-23-10-5-17)15-19(20)6-11-26(16-19)14-18-3-1-2-8-24-18/h1-5,8-10H,6-7,11-16H2.
What are the key properties of 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane?
10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane has a molecular weight of 358.44 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-difluoro-2-(pyridin-2-ylmethyl)-7-(pyridin-4-ylmethyl)-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 118747244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).