C24H34N4O9 — CID 118747346
[7-[(5-tert-butyl-2-methoxyphenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 118747346) has the molecular formula C24H34N4O9 and a molecular weight of 522.56 g/mol. Its IUPAC name is [7-[(5-tert-butyl-2-methoxyphenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | [7-[(5-tert-butyl-2-methoxyphenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 118747346 |
| Molecular Formula | C24H34N4O9 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [7-[(5-tert-butyl-2-methoxyphenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | COc1ccc(C(C)(C)C)cc1CN1CCn2c(CO)nnc2C1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26N4O2.C6H8O7/c1-18(2,3)14-5-6-15(24-4)13(9-14)10-21-7-8-22-16(11-21)19-20-17(22)12-23;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-6,9,23H,7-8,10-12H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ILETWJXUCRZCBL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 195.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |