C20H19NO6 — CID 11874762
(1S,2S,3R,7S,16S,17R,18R)-10-methoxy-15-oxo-6,21-dioxa-14-azahexacyclo[16.2.1.01,16.02,14.03,7.08,13]henicosa-8(13),9,11,19-tetraene-17-carboxylic acid (PubChem CID 11874762) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (1S,2S,3R,7S,16S,17R,18R)-10-methoxy-15-oxo-6,21-dioxa-14-azahexacyclo[16.2.1.01,16.02,14.03,7.08,13]henicosa-8(13),9,11,19-tetraene-17-carboxylic acid.
| Compound Name | (1S,2S,3R,7S,16S,17R,18R)-10-methoxy-15-oxo-6,21-dioxa-14-azahexacyclo[16.2.1.01,16.02,14.03,7.08,13]henicosa-8(13),9,11,19-tetraene-17-carboxylic acid |
|---|---|
| PubChem CID | 11874762 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (1S,2S,3R,7S,16S,17R,18R)-10-methoxy-15-oxo-6,21-dioxa-14-azahexacyclo[16.2.1.01,16.02,14.03,7.08,13]henicosa-8(13),9,11,19-tetraene-17-carboxylic acid |
| SMILES | COc1ccc2c(c1)[C@H]1OCC[C@@H]1[C@@H]1N2C(=O)[C@H]2[C@@H](C(=O)O)[C@H]3C=C[C@@]12O3 |
| InChI | InChI=1S/C20H19NO6/c1-25-9-2-3-12-11(8-9)16-10(5-7-26-16)17-20-6-4-13(27-20)14(19(23)24)15(20)18(22)21(12)17/h2-4,6,8,10,13-17H,5,7H2,1H3,(H,23,24)/t10-,13+,14-,15+,16-,17-,20-/m0/s1 |
| InChIKey | BSOQQWLMYGZOQB-UGIWWLGZSA-N |
| XLogP | 1.53 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|