C22H38N2O5 — CID 11874956
(3S,3aR,4aS,5R,8aR,9aR)-4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[(2-morpholin-4-ylethylamino)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 11874956) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is (3S,3aR,4aS,5R,8aR,9aR)-4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[(2-morpholin-4-ylethylamino)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,4aS,5R,8aR,9aR)-4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[(2-morpholin-4-ylethylamino)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11874956 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (3S,3aR,4aS,5R,8aR,9aR)-4a-hydroxy-5-methoxy-5,8a-dimethyl-3-[(2-morpholin-4-ylethylamino)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CO[C@]1(C)CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CNCCN4CCOCC4)[C@H]3C[C@]21O |
| InChI | InChI=1S/C22H38N2O5/c1-20-5-4-6-21(2,27-3)22(20,26)13-16-17(19(25)29-18(16)14-20)15-23-7-8-24-9-11-28-12-10-24/h16-18,23,26H,4-15H2,1-3H3/t16-,17-,18-,20-,21-,22+/m1/s1 |
| InChIKey | KIHWOIFCLKGLKQ-ZRJJWSOFSA-N |
| XLogP | 1.19 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|