About 2-nitrobenzoyl chloride
2-nitrobenzoyl chloride (PubChem CID 11875) has the molecular formula C7H4ClNO3
and a molecular weight of 185.57 g/mol. Its IUPAC name is 2-nitrobenzoyl chloride.
Molecular Properties
| Compound Name | 2-nitrobenzoyl chloride |
| PubChem CID | 11875 |
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight | 185.57 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | 2-nitrobenzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4ClNO3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H |
| InChIKey | BWWHTIHDQBHTHP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzoyl chloride?
The IUPAC name of 2-nitrobenzoyl chloride (CID 11875) is 2-nitrobenzoyl chloride.
What is the SMILES notation for 2-nitrobenzoyl chloride?
The canonical SMILES for 2-nitrobenzoyl chloride is O=C(Cl)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitrobenzoyl chloride?
The InChIKey is BWWHTIHDQBHTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H.
What are the key properties of 2-nitrobenzoyl chloride?
2-nitrobenzoyl chloride has a molecular weight of 185.57 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzoyl chloride is sourced from PubChem (CID 11875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).