C22H31F6N3O6 — CID 118751961
3,5-dimethyl-4-[[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118751961) has the molecular formula C22H31F6N3O6 and a molecular weight of 547.49 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,2-oxazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3,5-dimethyl-4-[[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118751961 |
| Molecular Formula | C22H31F6N3O6 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 3,5-dimethyl-4-[[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,2-oxazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1noc(C)c1CN1CCC2C1CCN2CC1CCOCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H29N3O2.2C2HF3O2/c1-13-16(14(2)23-19-13)12-21-8-4-17-18(21)3-7-20(17)11-15-5-9-22-10-6-15;2*3-2(4,5)1(6)7/h15,17-18H,3-12H2,1-2H3;2*(H,6,7) |
| InChIKey | BKFNTKKZGBHXSH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |