C28H20F3N5O4 — CID 118753413
(E)-but-2-enedioic acid;(3S)-3-[2-(difluoromethyl)-4-pyridinyl]-7-fluoro-3-(5-pyrimidin-5-yl(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)isoindol-1-amine (PubChem CID 118753413) has the molecular formula C28H20F3N5O4 and a molecular weight of 559.45 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3S)-3-[2-(difluoromethyl)-4-pyridinyl]-7-fluoro-3-(5-pyrimidin-5-yl(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)isoindol-1-amine.
| Compound Name | (E)-but-2-enedioic acid;(3S)-3-[2-(difluoromethyl)-4-pyridinyl]-7-fluoro-3-(5-pyrimidin-5-yl(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)isoindol-1-amine |
|---|---|
| PubChem CID | 118753413 |
| Molecular Formula | C28H20F3N5O4 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (E)-but-2-enedioic acid;(3S)-3-[2-(difluoromethyl)-4-pyridinyl]-7-fluoro-3-(5-pyrimidin-5-yl(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)isoindol-1-amine |
| SMILES | NC1=N[C@](c2ccnc(C(F)F)c2)([14c]2[14cH][14cH][14cH][14c](-c3cncnc3)[14cH]2)c2cccc(F)c21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H16F3N5.C4H4O4/c25-19-6-2-5-18-21(19)23(28)32-24(18,17-7-8-31-20(10-17)22(26)27)16-4-1-3-14(9-16)15-11-29-13-30-12-15;5-3(6)1-2-4(7)8/h1-13,22H,(H2,28,32);1-2H,(H,5,6)(H,7,8)/b;2-1+/t24-;/m0./s1/i1+2,3+2,4+2,9+2,14+2,16+2; |
| InChIKey | PFELQGNXJDRKDW-WOWHNWHHSA-N |
| XLogP | 4.34 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|