C21H24N4O2S — CID 118753479
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl](1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl]acetamide (PubChem CID 118753479) has the molecular formula C21H24N4O2S and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl](1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl](1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl]acetamide |
|---|---|
| PubChem CID | 118753479 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl](1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl]acetamide |
| SMILES | Nc1nc(CC(=O)N[14c]2[14cH][14cH][14c](CCNC[C@H](O)c3ccccc3)[14cH][14cH]2)cs1 |
| InChI | InChI=1S/C21H24N4O2S/c22-21-25-18(14-28-21)12-20(27)24-17-8-6-15(7-9-17)10-11-23-13-19(26)16-4-2-1-3-5-16/h1-9,14,19,23,26H,10-13H2,(H2,22,25)(H,24,27)/t19-/m0/s1/i6+2,7+2,8+2,9+2,15+2,17+2 |
| InChIKey | PBAPPPCECJKMCM-NDAYHVAPSA-N |
| XLogP | 2.77 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|