About 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol
4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol (PubChem CID 118753531) has the molecular formula C21H23ClFNO2
and a molecular weight of 375.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol |
| PubChem CID | 118753531 |
| Molecular Formula | C21H23ClFNO2 |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol |
| SMILES | OC(CCCN1C=CC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-11,14,20,25-26H,1-2,12-13,15H2 |
| InChIKey | MFRRKLRVXZYOMO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol?
The IUPAC name of 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol (CID 118753531) is 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol.
What is the SMILES notation for 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol?
The canonical SMILES for 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol is OC(CCCN1C=CC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol?
The InChIKey is MFRRKLRVXZYOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-11,14,20,25-26H,1-2,12-13,15H2.
What are the key properties of 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol?
4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol has a molecular weight of 375.87 g/mol, XLogP of 4.40, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-hydroxybutyl]-2,3-dihydropyridin-4-ol is sourced from PubChem (CID 118753531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).