About (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate
(Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate (PubChem CID 118753798) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate.
Molecular Properties
| Compound Name | (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate |
| PubChem CID | 118753798 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate |
| SMILES | CC1(C)C[C@@H]1C(=O)N/C(=C\CCCCC[N+](C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C17H30N2O3/c1-17(2)12-13(17)15(20)18-14(16(21)22)10-8-6-7-9-11-19(3,4)5/h10,13H,6-9,11-12H2,1-5H3,(H-,18,20,21,22)/b14-10-/t13-/m1/s1 |
| InChIKey | NOSQAJGISWGCEY-JFBXQDQPSA-N |
| XLogP | 1.05 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate?
The IUPAC name of (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate (CID 118753798) is (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate.
What is the SMILES notation for (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate?
The canonical SMILES for (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate is CC1(C)C[C@@H]1C(=O)N/C(=C\CCCCC[N+](C)(C)C)C(=O)[O-].
What is the InChIKey of (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate?
The InChIKey is NOSQAJGISWGCEY-JFBXQDQPSA-N. The full InChI is InChI=1S/C17H30N2O3/c1-17(2)12-13(17)15(20)18-14(16(21)22)10-8-6-7-9-11-19(3,4)5/h10,13H,6-9,11-12H2,1-5H3,(H-,18,20,21,22)/b14-10-/t13-/m1/s1.
What are the key properties of (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate?
(Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate has a molecular weight of 310.44 g/mol, XLogP of 1.05, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-8-(trimethylazaniumyl)oct-2-enoate is sourced from PubChem (CID 118753798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).