C14H18N4S2 — CID 118753921
methyl N'-methyl-N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]carbamimidothioate (PubChem CID 118753921) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is methyl N'-methyl-N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N'-methyl-N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 118753921 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl N'-methyl-N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]carbamimidothioate |
| SMILES | C/N=C(/Nc1cccc(C2CN3CCSC3=N2)c1)SC |
| InChI | InChI=1S/C14H18N4S2/c1-15-13(19-2)16-11-5-3-4-10(8-11)12-9-18-6-7-20-14(18)17-12/h3-5,8,12H,6-7,9H2,1-2H3,(H,15,16) |
| InChIKey | NTHWWYFAYLNOQK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|