C29H39N3O2 — CID 118754156
2-[4-[4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]piperidin-1-yl]phenyl]-1-pyrrolidin-1-ylethanone (PubChem CID 118754156) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[4-[4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]piperidin-1-yl]phenyl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]piperidin-1-yl]phenyl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 118754156 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 2-[4-[4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]piperidin-1-yl]phenyl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(Cc1ccc(N2CCC(N3CCC(C(O)c4ccccc4)CC3)CC2)cc1)N1CCCC1 |
| InChI | InChI=1S/C29H39N3O2/c33-28(32-16-4-5-17-32)22-23-8-10-26(11-9-23)31-20-14-27(15-21-31)30-18-12-25(13-19-30)29(34)24-6-2-1-3-7-24/h1-3,6-11,25,27,29,34H,4-5,12-22H2 |
| InChIKey | JEDSIOVBEJLZER-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|