About methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate
methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate (PubChem CID 118755153) has the molecular formula C20H26N4O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate |
| PubChem CID | 118755153 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)C1CCN(c2nc(C)c3cc(C)ccc3n2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-13-5-6-17-16(11-13)14(2)21-20(22-17)24-9-7-15(8-10-24)19(26)23(3)12-18(25)27-4/h5-6,11,15H,7-10,12H2,1-4H3 |
| InChIKey | JZMLAFUEYKQKPZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate?
The IUPAC name of methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate (CID 118755153) is methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate.
What is the SMILES notation for methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate?
The canonical SMILES for methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate is COC(=O)CN(C)C(=O)C1CCN(c2nc(C)c3cc(C)ccc3n2)CC1.
What is the InChIKey of methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate?
The InChIKey is JZMLAFUEYKQKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O3/c1-13-5-6-17-16(11-13)14(2)21-20(22-17)24-9-7-15(8-10-24)19(26)23(3)12-18(25)27-4/h5-6,11,15H,7-10,12H2,1-4H3.
What are the key properties of methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate?
methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate has a molecular weight of 370.45 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-(4,6-dimethylquinazolin-2-yl)piperidine-4-carbonyl]-methylamino]acetate is sourced from PubChem (CID 118755153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).