C20H34N2O2 — CID 118755195
1-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-5-[2-(2-methoxyethylamino)ethyl]pyrrolidin-2-one (PubChem CID 118755195) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-5-[2-(2-methoxyethylamino)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-5-[2-(2-methoxyethylamino)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118755195 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 1-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-5-[2-(2-methoxyethylamino)ethyl]pyrrolidin-2-one |
| SMILES | COCCNCCC1CCC(=O)N1CCC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H34N2O2/c1-20(2)16-5-4-15(18(20)14-16)9-12-22-17(6-7-19(22)23)8-10-21-11-13-24-3/h4,16-18,21H,5-14H2,1-3H3/t16-,17?,18-/m0/s1 |
| InChIKey | ACDJGVLXBMDCCO-RGBJRUIASA-N |
| XLogP | 2.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|