C22H25ClN4O3 — CID 118755947
1-[4-[[4-(2-chloropyridine-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 118755947) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is 1-[4-[[4-(2-chloropyridine-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-(2-chloropyridine-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 118755947 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-[4-[[4-(2-chloropyridine-4-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2ccc3c(c2)CN(C(=O)c2ccnc(Cl)c2)CCO3)CC1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-16(28)26-8-6-25(7-9-26)14-17-2-3-20-19(12-17)15-27(10-11-30-20)22(29)18-4-5-24-21(23)13-18/h2-5,12-13H,6-11,14-15H2,1H3 |
| InChIKey | DVXSNPPIXFPILR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|