C23H26ClN5O3 — CID 118756054
4-[[6-chloro-4-[(2,3-dimethoxyphenyl)methylamino]quinazolin-2-yl]methyl]piperazine-1-carbaldehyde (PubChem CID 118756054) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-[[6-chloro-4-[(2,3-dimethoxyphenyl)methylamino]quinazolin-2-yl]methyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[[6-chloro-4-[(2,3-dimethoxyphenyl)methylamino]quinazolin-2-yl]methyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 118756054 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[[6-chloro-4-[(2,3-dimethoxyphenyl)methylamino]quinazolin-2-yl]methyl]piperazine-1-carbaldehyde |
| SMILES | COc1cccc(CNc2nc(CN3CCN(C=O)CC3)nc3ccc(Cl)cc23)c1OC |
| InChI | InChI=1S/C23H26ClN5O3/c1-31-20-5-3-4-16(22(20)32-2)13-25-23-18-12-17(24)6-7-19(18)26-21(27-23)14-28-8-10-29(15-30)11-9-28/h3-7,12,15H,8-11,13-14H2,1-2H3,(H,25,26,27) |
| InChIKey | XFOUTVCMXCWLFQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|