C20H28N6O — CID 118756520
N-cyclopentyl-1-[1-[(6-methyl-2-pyridinyl)methyl]piperidin-4-yl]triazole-4-carboxamide (PubChem CID 118756520) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is N-cyclopentyl-1-[1-[(6-methyl-2-pyridinyl)methyl]piperidin-4-yl]triazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[1-[(6-methyl-2-pyridinyl)methyl]piperidin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 118756520 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-cyclopentyl-1-[1-[(6-methyl-2-pyridinyl)methyl]piperidin-4-yl]triazole-4-carboxamide |
| SMILES | Cc1cccc(CN2CCC(n3cc(C(=O)NC4CCCC4)nn3)CC2)n1 |
| InChI | InChI=1S/C20H28N6O/c1-15-5-4-8-17(21-15)13-25-11-9-18(10-12-25)26-14-19(23-24-26)20(27)22-16-6-2-3-7-16/h4-5,8,14,16,18H,2-3,6-7,9-13H2,1H3,(H,22,27) |
| InChIKey | ZCGHIROKPLYXRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |