C25H32FN3O4 — CID 118756895
5-[(4-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]-3-(oxolan-3-yl)imidazolidine-2,4-dione (PubChem CID 118756895) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]-3-(oxolan-3-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]-3-(oxolan-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118756895 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-5-[1-[(E)-4-methylpent-2-enoyl]piperidin-4-yl]-3-(oxolan-3-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)/C=C/C(=O)N1CCC(C2(Cc3ccc(F)cc3)NC(=O)N(C3CCOC3)C2=O)CC1 |
| InChI | InChI=1S/C25H32FN3O4/c1-17(2)3-8-22(30)28-12-9-19(10-13-28)25(15-18-4-6-20(26)7-5-18)23(31)29(24(32)27-25)21-11-14-33-16-21/h3-8,17,19,21H,9-16H2,1-2H3,(H,27,32)/b8-3+ |
| InChIKey | WQQBRTXUOWNIAE-FPYGCLRLSA-N |
| XLogP | 2.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|