C23H33N3O3 — CID 118757313
methyl (2S,4R)-4-(pyridine-2-carbonylamino)-1-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]pyrrolidine-2-carboxylate (PubChem CID 118757313) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is methyl (2S,4R)-4-(pyridine-2-carbonylamino)-1-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-(pyridine-2-carbonylamino)-1-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118757313 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | methyl (2S,4R)-4-(pyridine-2-carbonylamino)-1-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](NC(=O)c2ccccn2)CN1CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H33N3O3/c1-16-8-7-11-23(2,3)18(16)10-13-26-15-17(14-20(26)22(28)29-4)25-21(27)19-9-5-6-12-24-19/h5-6,9,12,17,20H,7-8,10-11,13-15H2,1-4H3,(H,25,27)/t17-,20+/m1/s1 |
| InChIKey | YLZFZTPDEJKBOO-XLIONFOSSA-N |
| XLogP | 3.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|