About 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol
4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol (PubChem CID 118757685) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol.
Molecular Properties
| Compound Name | 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol |
| PubChem CID | 118757685 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol |
| SMILES | COc1cc(CNCc2cc(-c3cccnc3)ccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O4/c1-26-20-9-15(10-21(27-2)22(20)28-3)12-24-14-18-11-16(6-7-19(18)25)17-5-4-8-23-13-17/h4-11,13,24-25H,12,14H2,1-3H3 |
| InChIKey | XWDKAHUFUYTXGT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol?
The IUPAC name of 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol (CID 118757685) is 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol.
What is the SMILES notation for 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol?
The canonical SMILES for 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol is COc1cc(CNCc2cc(-c3cccnc3)ccc2O)cc(OC)c1OC.
What is the InChIKey of 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol?
The InChIKey is XWDKAHUFUYTXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-26-20-9-15(10-21(27-2)22(20)28-3)12-24-14-18-11-16(6-7-19(18)25)17-5-4-8-23-13-17/h4-11,13,24-25H,12,14H2,1-3H3.
What are the key properties of 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol?
4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol has a molecular weight of 380.44 g/mol, XLogP of 3.77, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yl-2-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]phenol is sourced from PubChem (CID 118757685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).