C27H30N4O3 — CID 118758221
ethyl 4-[2-[benzyl(methyl)amino]-6-phenylpyridine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 118758221) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl 4-[2-[benzyl(methyl)amino]-6-phenylpyridine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[benzyl(methyl)amino]-6-phenylpyridine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118758221 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | ethyl 4-[2-[benzyl(methyl)amino]-6-phenylpyridine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(-c3ccccc3)nc2N(C)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N4O3/c1-3-34-27(33)31-18-16-30(17-19-31)26(32)23-14-15-24(22-12-8-5-9-13-22)28-25(23)29(2)20-21-10-6-4-7-11-21/h4-15H,3,16-20H2,1-2H3 |
| InChIKey | YVBBGVXXIHUXLB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |